Fluoride phosphate
The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, groups these as 22.1. The Nickel-Strunz grouping is 8.BN.
Related mixed anion compounds are the , the and .
Minerals[]
name | formula | ratio
PO4:F |
formula weight | crystal system | space group | unit cell | volume | density | refractive index | comment | reference |
---|---|---|---|---|---|---|---|---|---|---|---|
Althausite | Mg4(PO4)2(OH,O)(F,☐) | 2:~1 | Orthorhombic | Pnma | a = 8.258 b = 6.054, c = 14.383 | 719.06 | 2.97 | Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598
2V: measured: 70° , calculated: 80° Max birefringence: δ = 0.010 |
[1] | ||
Amblygonite | LiAl(PO4)F | 1:1 | Triclinic | P1 | a = 6.644 b = 7.744 c = 6.91
α = 90.35°, β = 117.33°, γ = 91.01° Z=4 |
315.75 | 3.04-3.11 | Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613
2V: Measured: 107° to 129.5° Birefringence: 0.020 |
[2] | ||
Ba2Ca18(SiO4)6(PO4)3(CO3)F3O | 3:3 | trigonal | R3m | a = 7.1255, c = 66.290 Z=3 | 2914.8 | [3] | |||||
Arctite | Na2Ca4(PO4)3F | 3:1 | Trigonal | R3m | a = 7.078 c = 41.203 Z=6 | 1,787.64 | 3.13 | Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001 | [4] | ||
BaCa12(SiO4)4(PO4)2F2O | Trigonal | R3m | a = 7.1551 c = 41.303 | 1381.2 | Uniaxial (-) nω = 1.650 nε = 1.647
Max Birefringence: δ = 0.003 |
[5] | |||||
Babefphite | BaBePO4(F,OH) | 1:~1 | Tetragonal | Uniaxial (+) nω = 1.629 nε = 1.632
Max birefringence: δ = 0.003 |
[6] | ||||||
NaCeSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.692 c = 7.201 | 585.80 | 4.19 | Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640
Birefringence: 0.015 |
[7] | |||
NaLaSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.647 c = 7.17 | 577.88 | 4.19 | Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636
Max birefringence: δ = 0.018 |
[8] | |||
Na2Sr2Al2PO4F9 | 1:9 | Monoclinic | Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469
2V: 80° Max birefringence:δ = 0.007 |
[9] | |||||||
NaNdCa3(PO4)3F | Trigonal | P3 | a = 9.4553 c = 6.9825 | 540.62 | 3.91 | [10] | |||||
Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O | 2:2 | Monoclinic | P21/b | a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4 | 1145.78 | 2.525 | Biaxial (-) nα = 1.548(2) nγ = 1.550(2)
2V: calculated: 56° Max brefringence: δ = 0.002 |
[11] | |||
(Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5 | Trigonal | P3 | a = 9.51 c = 7.01 Z=2 | 549.05 | 3.92 | Uniaxial (-) nω = 1.682 nε = 1.660
Max birefringence: δ = 0.022 |
[12] | ||||
Fluellite | Al2(PO4)F2(OH) · 7H2O | Orthorhombic | Fddd | a = 11.22 b = 21.15 c = 8.54 | 2,027 | 2.139 - 2.17 | Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511
Max birefringence: δ = 0.033 |
[13] | |||
Fluorapatite | Ca5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.3973 c = 6.8782 | 526.03 | 3.1-3.25 | Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646
Birefringence: 0.004 |
[14] | ||
Fluorcaphite | SrCaCa3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.485 c = 7.000 Z=2 | 545.39 | Uniaxial (-) nω = 1.649 nε = 1.637
Max birefringence: δ = 0.012 |
[15] | |||
Ca2Pb3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.640, c = 7.012 Z=2 | 564.4 | 5.445 | Uniaxial (-) nω = 1.836 nε = 1.824
Max birefringence: δ = 0.012 |
[16] | |||
SrCaSr3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.565 c = 7.115 Z=2 | 563.74 | Uniaxial (-) nω = 1.651 nε = 1.637
Max birefringence: δ = 0.014 |
[17] | ||||
Francolite | |||||||||||
Herderite | CaBe(PO4)F | Monoclinic | a = 4.81, b = 7.7 c = 9.82 β = 90.1° | 363.7 | 3.02 | Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620
2V: calculated: 70° Max birefringence: δ = 0.033 |
[18] | ||||
Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O | 4:~15 | Trigonal | P3 2 1 | a = 6.988 c = 16.707 | 706.5 | [19] | |||||
CaMg(PO4)F | Monoclinic | B2/b | a = 6.52 b = 8.75 c = 7.51 β = 121.47° | 365.4 | 3.15-3.27 | Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615
2V: ,easured: 51° Max birefringence: δ = 0.025 |
[20] | ||||
Al3(PO4)2F2(OH) · 7H2O | 2:2 | Triclinic | a = 9.15 b = 10 c = 7.24
α = 98.6°, β = 93.6°, γ = 93.2° |
Biaxial | [21] | ||||||
NaCeBa3(PO4)3F0.5Cl0.5 | 6:1 | Trigonal | P3 | a = 9.909 c = 7.402 | 629.42 | 4.51 | [22] | ||||
NaAl(PO4)F | 1:1 | Monoclinic | B2/b | a = 6.414 b = 8.207 c = 6.885 β = 115.47° | 327.20 | 3.126 - 3.29 | Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580
2V: measured: 89° Birefringence: 0.034 |
[23] | |||
(Mg,Fe2+,Mn2+)2PO4F | 1:1 | Monoclinic | a = 11.92 b = 12.27 c = 9.66 β = 107.18° | 1349.8 | Biaxial (+) nα = 1.641 nβ = 1.649 nγ = 1.661
2V: measured: 60° , calculated: 80° Max birefringence: δ = 0.020 |
[24] | |||||
Fe3Al2(PO4)3(PO3OH)F · 18H2O | 4:1 | Triclinic | a = 10.05 b = 11.56 c = 6.88
α = 105.84°, β = 93.66°, γ = 106.47° |
728.7 | Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534
2V: measured: 55° to 59.7°, calculated: 58° Max birefringence:δ = 0.012 |
[25] | |||||
Minyulite | KAl2(PO4)2(OH,F) · 4H2O | 2:~1 | Orthorhombic | Pba2 | a = 9.34 b = 9.74 c = 5.52 | 502 | 2.47 | Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538
2V: measured: 70° , calculated: 82° Max birefringence: δ = 0.007 |
[26] | ||
(Sr,Ca)2Ba3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.921, c = 7.469 Z=2 | 636.7 | 4.511 | [27] | ||||
NaCa2Al2(PO4)2(OH)F4 · 2H2O | 2:4 | Monoclinic | 2.94 | Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565
2V: measured: 43° , calculated: 44° Max birefringence: δ = 0.014 |
[28] | ||||||
Na2Ca(PO4)F | Monoclinic | P21/b | a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8 | 922.81 | Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520
2V: 80° Max birefringence: δ = 0.012 |
[29] | |||||
Na7(PO4)2F.19H2O | 2:1 | Isometric | Fd3c | a = 27.79 Z=56 | 21,461.78 | 1,71-1.72 | Isotropic | [30][31] | |||
Na5Ca4(PO4)4F | 4:1 | Triclinic | a = 5.4 Å, b = 11.64 Å, c = 16.48 Å
α = 134.99°, β = 90.04°, γ = 89.96° |
732.60 | Biaxial (+) nα = 1.571 nγ = 1.590
Max birefringence: δ = 0.019 |
[32] | |||||
Nevadaite | (Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O | 8:8 | Orthorhombic | P21mn | a = 12.123 b = 18.999 c = 4.961 | 2.54 | Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553
2V: measured: 76°, calculated: 76° Max birefringence: δ = 0.013 |
[33] | |||
CaMg(PO4)(OH,F) | 1:~1 | monoclinic | a = 6.53 b = 8.75 c = 6.91 β = 112.33° | 365.2 | 3.27 | Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616
2V: measured: 51° , calculated: 58° Max birefringence: δ = 0.026 |
[34] | ||||
CaFe3+2(PO4)2(OH,F)2 | 2:~2 | a = 5.18 c = 12.61 | [35] | ||||||||
Sr5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.845 c = 7.383 | 619.72 | Uniaxial (-) nω = 1.630(1) nε = 1.623(1)
Max birefringence: δ = 0.007 |
[36] | ||||
Triplite | Mn2+2(PO4)F | 1:1 | Monoclinic | P21/b | a = 11.9 b = 6.52 c = 10.09 β = 105.62° | 758.4 | 3.9 | Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680
2V: measured: 70° to 90°, calculated: 72° Max birefringence: δ = 0.030 |
[37] | ||
Väyrynenite | Mn2+Be(PO4)(OH,F) | 1:~1 | Monoclinic | P21/b | a = 5.411 b = 14.49 c = 4.73 β = 102.75° | 361.71 | 3.22 | Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667
2V: measured: 46° to 55°, Ccalculated: 51° to 57° Max birefringence: δ = 0.026 - 0.027 |
[38] | ||
Na(Ca,Mn2+)Al(PO4)(F,OH)3 | 1:~3 | Monoclinic | a = 6.83 b = 7.14 c = 5.44 β = 109.37° | 250.27 | Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571
2V: measured: 81° , calculated: 80° Max birefringence: δ = 0.014 |
[39] | |||||
Wagnerite | (Mg,Fe2+)2(PO4)F | 1:1 | Monoclinic | P21/b | a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)° | 3454.8 | 3.15 | Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582
2V: Measured: 25° to 35° ? Birefringence:0.046 Max birefringence: δ = 0.015 |
[40] | ||
Wavellite | Al3(PO4)2(OH,F)3 · 5H2O | 2:~3 | Orthorhombic | a = 9.621 b = 17.363 c = 6.994 | 1168.3 | 2.36 | Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561
2V: measured: 60° to 72°, calculated: 60° to 70° Max birefringence: δ = 0.026 |
[41] | |||
Fe2+2(PO4)F | 1:1 | Monoclinic | P21/b | 753.82 | Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713
2V: measured: 58° , calculated: 60° Max birefringence: δ = 0.017 |
[42] | |||||
Na5-4.5PO4(CO3,F,Cl) | 1:~1 | [30] |
Artificial[]
name | formula | formula weight | crystal system | space group | unit cell Å | volume | density | refractive index | comment | reference |
---|---|---|---|---|---|---|---|---|---|---|
Iron-Doped Sodium–Vanadium Fluorophosphate | Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3) | tetrahedral | P42/mnm | a=9.0277 c=10.6259 | 866.0 | [43] | ||||
Na3V2O1.6(PO4)2F1.4 | [43] | |||||||||
Na2MnPO4F | [44] | |||||||||
α | Na2FePO4F | monoclinic | P21/c | a = 13.675, b = 5.2503, c = 13.7202, β = 120.230° | [44] | |||||
β | Na2FePO4F | orthorhombic | [44] | |||||||
MIL-145 | RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O | 3187.11 | monoclinic | P2 | a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1 | 2037.30 | 2.598 | colourless | [45] | |
K2SnPO4F3 | 348.86 | monoclinic | P21/c | a=10.039 b=9.415 c=21.602 beta=95.464 Z=12 | 2032.6 | 3.420 | colourless | [46] | ||
K6Sn(P2O7)2F2 | 739.17 | monoclinic | P21/c | a=8.515 b=12.400 c=8.403 beta=99.58 Z=29 | 874.8 | 2.806 | colourless | [46] | ||
K2Sb(P2O7)F | tetragonal | P4bm | a=8.5239 c=5.572 Z=2 | 404.8 | 3.223 | colourless SHG 4.0×KDP | [47] |
References[]
- ^ "Althausite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Amblygonite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ Krüger, Biljana; Krüger, Hannes; Galuskin, Evgeny V.; Galuskina, Irina O.; Vapnik, Yevgeny; Olieric, Vincent; Pauluhn, Anuschka (2018-12-01). "Aravaite, Ba 2 Ca 18 (SiO 4 ) 6 (PO 4 ) 3 (CO 3 )F 3 O: modular structure and disorder of a new mineral with single and triple antiperovskite layers". Acta Crystallographica Section B. 74 (6): 492–501. doi:10.1107/S2052520618012271. ISSN 2052-5206.
- ^ "Arctite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Ariegilatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Babefphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(La): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Bøggildite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Carlgieseckeite-(Nd): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Cloncurryite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Deloneite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorapatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorcaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorphosphohedyphane: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorstrophite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Herderite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Iangreyite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Isokite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Kingite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Kuannersuite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Lacroixite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Magniotriplite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Mcauslanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Minyulite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Miyahisaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Morinite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nacaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ a b Mitchell, R. H. (5 July 2018). "An ephemeral pentasodium phosphate carbonate from natrocarbonatite lapilli, Oldoinyo Lengai, Tanzania". Mineralogical Magazine. 70 (2): 211–218. doi:10.1180/0026461067020326. S2CID 140140550.
- ^ "Natrophosphate: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nefedovite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nevadaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Panasqueiraite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Richellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Stronadelphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Triplite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Väyrynenite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Viitaniemiite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wagnerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wavellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Zwieselite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ a b Palomares, Verónica; Iturrondobeitia, Amaia; Sanchez-Fontecoba, Paula; Goonetilleke, Damian; Sharma, Neeraj; Lezama, Luis; Rojo, Teófilo (16 December 2019). "Iron-Doped Sodium–Vanadium Fluorophosphates: Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)". Inorganic Chemistry. 59 (1): 854–862. doi:10.1021/acs.inorgchem.9b03111. PMID 31840984.
- ^ a b c Kirsanova, Maria A.; Akmaev, Alexey S.; Aksyonov, Dmitry A.; Ryazantsev, Sergey V.; Nikitina, Victoria A.; Filimonov, Dmitry S.; Avdeev, Maxim; Abakumov, Artem M. (2020-11-16). "Monoclinic α-Na 2 FePO 4 F with Strong Antisite Disorder and Enhanced Na + Diffusion". Inorganic Chemistry. 59 (22): 16225–16237. doi:10.1021/acs.inorgchem.0c01961. ISSN 0020-1669. PMID 33137251.
- ^ Martineau, Charlotte; Loiseau, Thierry; Beitone, Lionel; Férey, Gérard; Bouchevreau, Boris; Taulelle, Francis (2013). "Single-crystal XRD and solid-state NMR structural resolution of a layered fluorinated gallium phosphate: RbGa 3 (PO 4 ) 2 (HPO 4 )F 4 ·C 5 N 2 H 16 ·2H 2 O (MIL-145)". Dalton Trans. 42 (2): 422–431. doi:10.1039/C2DT31464A. ISSN 1477-9226.
- ^ a b Hu, Shuaishuai; Su, Zhi (2019). "Two new tin( iv )-containing phosphate fluorides with two types of Sn( iv )–P–O–F frameworks and short cutoff edges". New Journal of Chemistry. 43 (41): 16127–16130. doi:10.1039/C9NJ04424H. ISSN 1144-0546.
- ^ Deng, Yalan; Huang, Ling; Dong, Xuehua; Wang, Lei; Ok, Kang Min; Zeng, Hongmei; Lin, Zhien; Zou, Guohong (2020-11-16). "K 2 Sb(P 2 O 7 )F: Cairo Pentagonal Layer with Bifunctional Genes Reveal Optical Performance". Angewandte Chemie International Edition. 59 (47): 21151–21156. doi:10.1002/anie.202009441. ISSN 1433-7851.
- Fluorides
- Phosphates
- Mixed anion compounds